CAS 565194-83-4 appears in our catalog under these names: 2-Chloro-n-[2-methoxy-5-(morpholine-4-sulfonyl)-phenyl]-acetamide, 95%, 2-Chloro-N-(2-methoxy-5-(morpholine-4-sulfonyl)phenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-chloro-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide (CAS 565194-83-4) is a chemical compound with the molecular formula C13H17ClN2O5S and a molecular weight of 348.80 g/mol. IUPAC name: 2-chloro-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide. InChIKey: ZMUXZRVJHOCIFU-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O5S |
|---|---|
| Molecular weight | 348.80 g/mol |
| IUPAC name | 2-chloro-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide |
| InChIKey | ZMUXZRVJHOCIFU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCOCC2)NC(=O)CCl |
Computed by PubChem (NCBI)