CAS 923812-64-0 is the registry number for 4-{(2-chloro-5-(dimethylsulfamoyl)phenyl)formamido}butanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]butanoic acid (CAS 923812-64-0) is a chemical compound with the molecular formula C13H17ClN2O5S and a molecular weight of 348.80 g/mol. IUPAC name: 4-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]butanoic acid. InChIKey: KVNRPMUQPTUMPX-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O5S |
|---|---|
| Molecular weight | 348.80 g/mol |
| IUPAC name | 4-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]butanoic acid |
| InChIKey | KVNRPMUQPTUMPX-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)Cl)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)