CAS 56542-68-8 appears in our catalog under these names: 3-Sulfamoylbenzene-1-carbothioamide, 95%, 3-Sulfamoylbenzene-1-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-sulfamoylbenzenecarbothioamide (CAS 56542-68-8) is a chemical compound with the molecular formula C7H8N2O2S2 and a molecular weight of 216.3 g/mol. IUPAC name: 3-sulfamoylbenzenecarbothioamide. InChIKey: FREQQHVRMDVJQF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S2 |
|---|---|
| Molecular weight | 216.3 g/mol |
| IUPAC name | 3-sulfamoylbenzenecarbothioamide |
| InChIKey | FREQQHVRMDVJQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)C(=S)N |
Computed by PubChem (NCBI)