Products 90151-13-6

CAS 90151-13-6 appears in our catalog under these names: 2,6-Bis(methylsulfanyl)pyrimidine-4-carboxylic acid, 95%, 2,6-Bis(methylthio)pyrimidine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid (CAS 90151-13-6) is a chemical compound with the molecular formula C7H8N2O2S2 and a molecular weight of 216.3 g/mol. IUPAC name: 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid. InChIKey: LFMIYGGCSDSQAL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O2S2
Molecular weight216.3 g/mol
IUPAC name2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid
InChIKeyLFMIYGGCSDSQAL-UHFFFAOYSA-N
SMILESCSC1=NC(=NC(=C1)C(=O)O)SC

Computed by PubChem (NCBI)