CAS 90151-13-6 appears in our catalog under these names: 2,6-Bis(methylsulfanyl)pyrimidine-4-carboxylic acid, 95%, 2,6-Bis(methylthio)pyrimidine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid (CAS 90151-13-6) is a chemical compound with the molecular formula C7H8N2O2S2 and a molecular weight of 216.3 g/mol. IUPAC name: 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid. InChIKey: LFMIYGGCSDSQAL-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S2 |
|---|---|
| Molecular weight | 216.3 g/mol |
| IUPAC name | 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylic acid |
| InChIKey | LFMIYGGCSDSQAL-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=NC(=C1)C(=O)O)SC |
Computed by PubChem (NCBI)