Products 56600-73-8
CAS 56600-73-8 is the registry number for AKR1C2/3-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-methoxynaphthalen-2-yl)butanoic acid (CAS 56600-73-8) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 244.28 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)butanoic acid. InChIKey: LSDAHSHHKKHOKE-UHFFFAOYSA-N.
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)butanoic acid |
| InChIKey | LSDAHSHHKKHOKE-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)