CAS 56619-93-3 appears in our catalog under these names: N–(3–Methoxyphenyl)pivalamide, N-(3-methoxyphenyl)-2,2-dimethylpropanamide, 97%, N-(3-methoxyphenyl)-2,2-dimethylpropanamide, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 25g, 5g.
N-(3-methoxyphenyl)-2,2-dimethylpropanamide (CAS 56619-93-3) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-(3-methoxyphenyl)-2,2-dimethylpropanamide. InChIKey: DAFHCFQPQMYDFI-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-(3-methoxyphenyl)-2,2-dimethylpropanamide |
| InChIKey | DAFHCFQPQMYDFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)