CAS 56674-87-4 appears in our catalog under these names: 4-Oxoadamantane-1-carboxylic Acid, 4-Oxo-1-adamantanecarboxylic acid, 4-Oxoadamantane-1-carboxylic acid 98%, 4-Oxoadamantane-1-carboxylic acid, 97%, 4-oxoadamantane-1-carboxylic acid, 98%, 98%. Offered by: Chemat Brand, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: on request, 2g, 5g, 10g, 25g, 50g, 1g, 100g.
4-oxoadamantane-1-carboxylic acid (CAS 56674-87-4) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-oxoadamantane-1-carboxylic acid. InChIKey: VFNJWHFPIRNNRQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-oxoadamantane-1-carboxylic acid |
| InChIKey | VFNJWHFPIRNNRQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC(C2)(CC1C3=O)C(=O)O |
Computed by PubChem (NCBI)