CAS 567-15-7 appears in our catalog under these names: 2,2'-Bis-(trifluoromethyl)biphenyl, 95%, 2,2'-Bis-(Trifluoromethyl)biphenyl. Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 5g, 1g, 500mg.
1-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]benzene (CAS 567-15-7) is a chemical compound with the molecular formula C14H8F6 and a molecular weight of 290.20 g/mol. IUPAC name: 1-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]benzene. InChIKey: VBFVFTVNLQCICW-UHFFFAOYSA-N.
| Molecular formula | C14H8F6 |
|---|---|
| Molecular weight | 290.20 g/mol |
| IUPAC name | 1-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]benzene |
| InChIKey | VBFVFTVNLQCICW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)