CAS 581-80-6 appears in our catalog under these names: 4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, 95-<97%, 4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, ≥97-<99%, 4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, >98.0%(GC), 1,1'-Biphenyl, 4,4'-bis(trifluoromethyl)-, 98%, 98%, 4,4'-Bis(trifluoromethyl)biphenyl, 98%. Offered by: Hoffman Fine Chemicals, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200mg, 1g, 100mg.
1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene (CAS 581-80-6) is a chemical compound with the molecular formula C14H8F6 and a molecular weight of 290.20 g/mol. IUPAC name: 1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene. InChIKey: ITBRQMPOQQZNFT-UHFFFAOYSA-N.
| Molecular formula | C14H8F6 |
|---|---|
| Molecular weight | 290.20 g/mol |
| IUPAC name | 1-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]benzene |
| InChIKey | ITBRQMPOQQZNFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)