Products 56707-25-6
CAS 56707-25-6 is the registry number for (S)-Mabuterol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol (CAS 56707-25-6) is a chemical compound with the molecular formula C13H18ClF3N2O and a molecular weight of 310.74 g/mol. IUPAC name: (1S)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol. InChIKey: JSJCTEKTBOKRST-SNVBAGLBSA-N.
| Molecular formula | C13H18ClF3N2O |
|---|---|
| Molecular weight | 310.74 g/mol |
| IUPAC name | (1S)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol |
| InChIKey | JSJCTEKTBOKRST-SNVBAGLBSA-N |
| SMILES | CC(C)(C)NC[C@H](C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O |
Computed by PubChem (NCBI)