CAS 56711-06-9 appears in our catalog under these names: Ac-ile-nh2, 98%, Ac–Ile–NH₂, (2S,3S)-2-Acetamido-3-methylpentanamide, ≥97%, ≥97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g.
(2S,3S)-2-acetamido-3-methylpentanamide (CAS 56711-06-9) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: (2S,3S)-2-acetamido-3-methylpentanamide. InChIKey: WFBXRBMLCXMBBM-FSPLSTOPSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (2S,3S)-2-acetamido-3-methylpentanamide |
| InChIKey | WFBXRBMLCXMBBM-FSPLSTOPSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N)NC(=O)C |
Computed by PubChem (NCBI)