CAS 56724-21-1 appears in our catalog under these names: Thiamphenicol Impurity 1 HCl, Thiamphenicol Amine HCl, (1R,2R)-2-Amino-1-(4-(methylsulfonyl)phenyl)-1,3-propanediol Hydrochloride. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1g.
(1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride (CAS 56724-21-1) is a chemical compound with the molecular formula C10H16ClNO4S and a molecular weight of 281.76 g/mol. IUPAC name: (1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride. InChIKey: LDWKRIYCDUIKKD-BAUSSPIASA-N.
| Molecular formula | C10H16ClNO4S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | (1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride |
| InChIKey | LDWKRIYCDUIKKD-BAUSSPIASA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@H](CO)N)O.Cl |
Computed by PubChem (NCBI)