CAS 93839-90-8 is the registry number for Thiamphenicol Impurity 8 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride (CAS 93839-90-8) is a chemical compound with the molecular formula C10H16ClNO4S and a molecular weight of 281.76 g/mol. IUPAC name: (1S,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride. InChIKey: LDWKRIYCDUIKKD-IYPAPVHQSA-N.
| Molecular formula | C10H16ClNO4S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | (1S,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol;hydrochloride |
| InChIKey | LDWKRIYCDUIKKD-IYPAPVHQSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@@H]([C@H](CO)N)O.Cl |
Computed by PubChem (NCBI)