Products 5673-36-9
CAS 5673-36-9 is the registry number for Dihydroisopimaric Acid. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, Get quote.
(1S,4aR,4bS,7S)-7-ethyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid (CAS 5673-36-9) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 304.5 g/mol. IUPAC name: (1S,4aR,4bS,7S)-7-ethyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid. InChIKey: NQJDHQUUJULIEJ-MWDBYQCVSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | (1S,4aR,4bS,7S)-7-ethyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
| InChIKey | NQJDHQUUJULIEJ-MWDBYQCVSA-N |
| SMILES | CC[C@]1(CC[C@H]2C(=CCC3[C@@]2(CCC[C@]3(C)C(=O)O)C)C1)C |
Computed by PubChem (NCBI)