CAS 69254-37-1 appears in our catalog under these names: Arachidonic Acid–d8, Arachidonic Acid-d8, Arachidonic Acid-d8 (Major, 10mg/ml in Methyl Acetate), Arachidonic-5,6,8,9,11,12,14,15-d8 acid, ARACHIDONIC-5,6,8,9,11,12,14,15-D8 ACID&. Offered by: GLPBio, Chemat Brand, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: 1mg, on request, 5mg, 10mg, 2mg, 1 mg (32.00 mM * 100 μL in Methyl acetate).
(5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoic acid (CAS 69254-37-1) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 312.5 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoic acid. InChIKey: YZXBAPSDXZZRGB-FBFLGLDDSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoic acid |
| InChIKey | YZXBAPSDXZZRGB-FBFLGLDDSA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\C/C(=C(/[2H])\C/C(=C(/[2H])\CCCC(=O)O)/[2H])/[2H])/[2H])/CCCCC |
Computed by PubChem (NCBI)