CAS 5676-65-3 appears in our catalog under these names: (E)-3-(4-(Dimethylamino)phenyl)acrylic acid, 98%, (E)-3-(4-(Dimethylamino)phenyl)acrylic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
(E)-3-[4-(dimethylamino)phenyl]prop-2-enoic acid (CAS 5676-65-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (E)-3-[4-(dimethylamino)phenyl]prop-2-enoic acid. InChIKey: CQNPVMCASGWEHM-VMPITWQZSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (E)-3-[4-(dimethylamino)phenyl]prop-2-enoic acid |
| InChIKey | CQNPVMCASGWEHM-VMPITWQZSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)