CAS 5676-79-9 is the registry number for alpha,alpha'-Azocumene. Offered by: TRC. Available pack sizes: 100mg.
Bis(2-phenylpropan-2-yl)diazene (CAS 5676-79-9) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 266.4 g/mol. IUPAC name: bis(2-phenylpropan-2-yl)diazene. InChIKey: UCBZFPNTALHVAT-UHFFFAOYSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | bis(2-phenylpropan-2-yl)diazene |
| InChIKey | UCBZFPNTALHVAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)N=NC(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)