CAS 56766-76-8 is the registry number for Potassium 3-isopropoxy-3-oxopropanoate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Potassium 3-oxo-3-propan-2-yloxypropanoate (CAS 56766-76-8) is a chemical compound with the molecular formula C6H9KO4 and a molecular weight of 184.23 g/mol. IUPAC name: potassium 3-oxo-3-propan-2-yloxypropanoate. InChIKey: UWEFGXCUXWDZGI-UHFFFAOYSA-M.
| Molecular formula | C6H9KO4 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | potassium 3-oxo-3-propan-2-yloxypropanoate |
| InChIKey | UWEFGXCUXWDZGI-UHFFFAOYSA-M |
| SMILES | CC(C)OC(=O)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)