CAS 67024-84-4 is the registry number for Potassium (2-methyl-1,3-dioxolan-2-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Potassium 2-(2-methyl-1,3-dioxolan-2-yl)acetate (CAS 67024-84-4) is a chemical compound with the molecular formula C6H9KO4 and a molecular weight of 184.23 g/mol. IUPAC name: potassium 2-(2-methyl-1,3-dioxolan-2-yl)acetate. InChIKey: AERNMHXYAYHLFC-UHFFFAOYSA-M.
| Molecular formula | C6H9KO4 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | potassium 2-(2-methyl-1,3-dioxolan-2-yl)acetate |
| InChIKey | AERNMHXYAYHLFC-UHFFFAOYSA-M |
| SMILES | CC1(OCCO1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)