Products 568566-62-1
CAS 568566-62-1 is the registry number for 6-Chloro-N,N-bis(propan-2-yl)pyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-N,N-di(propan-2-yl)pyridine-3-sulfonamide (CAS 568566-62-1) is a chemical compound with the molecular formula C11H17ClN2O2S and a molecular weight of 276.78 g/mol. IUPAC name: 6-chloro-N,N-di(propan-2-yl)pyridine-3-sulfonamide. InChIKey: UBAWWMMWTSPSHA-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O2S |
|---|---|
| Molecular weight | 276.78 g/mol |
| IUPAC name | 6-chloro-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
| InChIKey | UBAWWMMWTSPSHA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)