Products 56895-12-6

CAS 56895-12-6 is the registry number for 2-(4-Bromophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-bromophenoxy)propanoyl chloride (CAS 56895-12-6) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 2-(4-bromophenoxy)propanoyl chloride. InChIKey: LHMKCZJMSGRBSV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO2
Molecular weight263.51 g/mol
IUPAC name2-(4-bromophenoxy)propanoyl chloride
InChIKeyLHMKCZJMSGRBSV-UHFFFAOYSA-N
SMILESCC(C(=O)Cl)OC1=CC=C(C=C1)Br

Computed by PubChem (NCBI)