Products 569-51-7
CAS 569-51-7 appears in our catalog under these names: Hemimellitic Acid, Hemimellitic acid, Hemimellitic Acid, >98.0%(T), Benzene-1，2，3-tricarboxylic acid, 98%, 98%, 1,2,3-Benzenetricarboxylic acid, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 2g, 10g, 50g, 1g.
Benzene-1,2,3-tricarboxylic acid (CAS 569-51-7) is a chemical compound with the molecular formula C9H6O6 and a molecular weight of 210.14 g/mol. IUPAC name: benzene-1,2,3-tricarboxylic acid. InChIKey: UJMDYLWCYJJYMO-UHFFFAOYSA-N.
| Molecular formula | C9H6O6 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | benzene-1,2,3-tricarboxylic acid |
| InChIKey | UJMDYLWCYJJYMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)