Products 7168-98-1
CAS 7168-98-1 appears in our catalog under these names: 1,3-BENZODIOXOLE-4,7-DICARBOXYLIC ACID, 97%, 97%, Benzo[d][1,3]dioxole-4,7-dicarboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
1,3-benzodioxole-4,7-dicarboxylic acid (CAS 7168-98-1) is a chemical compound with the molecular formula C9H6O6 and a molecular weight of 210.14 g/mol. IUPAC name: 1,3-benzodioxole-4,7-dicarboxylic acid. InChIKey: LCRUHAKTHGVHBI-UHFFFAOYSA-N.
| Molecular formula | C9H6O6 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 1,3-benzodioxole-4,7-dicarboxylic acid |
| InChIKey | LCRUHAKTHGVHBI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C=CC(=C2O1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)