CAS 5698-68-0 is the registry number for 5H-Thiochromeno[2,3-b]pyridin-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Thiochromeno[2,3-b]pyridin-5-one (CAS 5698-68-0) is a chemical compound with the molecular formula C12H7NOS and a molecular weight of 213.26 g/mol. IUPAC name: thiochromeno[2,3-b]pyridin-5-one. InChIKey: VEOSCXKPFWPNIA-UHFFFAOYSA-N.
| Molecular formula | C12H7NOS |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | thiochromeno[2,3-b]pyridin-5-one |
| InChIKey | VEOSCXKPFWPNIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)N=CC=C3 |
Computed by PubChem (NCBI)