CAS 581-30-6 appears in our catalog under these names: 3-Phenothiazone, 95%, 3H-Phenothiazin-3-One, 3H–phenothiazin–3–one. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 1g, 250mg, 100mg, on request.
Phenothiazin-3-one (CAS 581-30-6) is a chemical compound with the molecular formula C12H7NOS and a molecular weight of 213.26 g/mol. IUPAC name: phenothiazin-3-one. InChIKey: YKGCCFHSXQHWIG-UHFFFAOYSA-N.
| Molecular formula | C12H7NOS |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | phenothiazin-3-one |
| InChIKey | YKGCCFHSXQHWIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=O)C=C3S2 |
Computed by PubChem (NCBI)