CAS 570432-61-0 appears in our catalog under these names: 3-(Pyrazin-2-yl)phenol, 98%, 3-(Pyrazin-2-yl)phenol, 97%, 97%, 3-PYRAZIN-2-YLPHENOL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-pyrazin-2-ylphenol (CAS 570432-61-0) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 3-pyrazin-2-ylphenol. InChIKey: UMVRGASPEUGOOX-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 3-pyrazin-2-ylphenol |
| InChIKey | UMVRGASPEUGOOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)