CAS 57070-71-0 appears in our catalog under these names: 3,4-Diaminobenzophenone monohydrochloride, 95%, (3,4-Diaminophenyl)(phenyl)methanone hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
(3,4-diaminophenyl)-phenylmethanone;hydrochloride (CAS 57070-71-0) is a chemical compound with the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone;hydrochloride. InChIKey: VNCHICMXBKDTOS-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | (3,4-diaminophenyl)-phenylmethanone;hydrochloride |
| InChIKey | VNCHICMXBKDTOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N.Cl |
Computed by PubChem (NCBI)