Products 57070-71-0

CAS 57070-71-0 appears in our catalog under these names: 3,4-Diaminobenzophenone monohydrochloride, 95%, (3,4-Diaminophenyl)(phenyl)methanone hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(3,4-diaminophenyl)-phenylmethanone;hydrochloride (CAS 57070-71-0) is a chemical compound with the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone;hydrochloride. InChIKey: VNCHICMXBKDTOS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13ClN2O
Molecular weight248.71 g/mol
IUPAC name(3,4-diaminophenyl)-phenylmethanone;hydrochloride
InChIKeyVNCHICMXBKDTOS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N.Cl

Computed by PubChem (NCBI)