Products 956046-50-7
CAS 956046-50-7 appears in our catalog under these names: 5-Chloro-1-(2,5-dimethylphenyl)-3-methyl-1h-pyrazole-4-carbaldehyde, 95%, 5-Chloro-1-(2,5-dimethylphenyl)-3-methyl-1H-pyrazole-4-carbaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazole-4-carbaldehyde (CAS 956046-50-7) is a chemical compound with the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. IUPAC name: 5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazole-4-carbaldehyde. InChIKey: BFRJVMAJUNVUDR-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | 5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazole-4-carbaldehyde |
| InChIKey | BFRJVMAJUNVUDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=C(C(=N2)C)C=O)Cl |
Computed by PubChem (NCBI)