Products 571153-08-7
CAS 571153-08-7 appears in our catalog under these names: 2-Chloro-n-(2-chloro-4-fluorophenyl)propanamide, 95%, N-(2-Chloro-4-fluorophenyl)-2-chloropropanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 5000mg.
2-chloro-N-(2-chloro-4-fluorophenyl)propanamide (CAS 571153-08-7) is a chemical compound with the molecular formula C9H8Cl2FNO and a molecular weight of 236.07 g/mol. IUPAC name: 2-chloro-N-(2-chloro-4-fluorophenyl)propanamide. InChIKey: YGJQRDCXOFVULB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2FNO |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-4-fluorophenyl)propanamide |
| InChIKey | YGJQRDCXOFVULB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(C=C1)F)Cl)Cl |
Computed by PubChem (NCBI)