Products 949204-45-9
CAS 949204-45-9 is the registry number for N-(4-Chloro-2-fluorophenyl)-2-chloropropanamide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-chloro-N-(4-chloro-2-fluorophenyl)propanamide (CAS 949204-45-9) is a chemical compound with the molecular formula C9H8Cl2FNO and a molecular weight of 236.07 g/mol. IUPAC name: 2-chloro-N-(4-chloro-2-fluorophenyl)propanamide. InChIKey: AOFHXTGYYFGIRP-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2FNO |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-chloro-N-(4-chloro-2-fluorophenyl)propanamide |
| InChIKey | AOFHXTGYYFGIRP-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(C=C1)Cl)F)Cl |
Computed by PubChem (NCBI)