CAS 57148-95-5 is the registry number for 5-Bromo-3-(bromomethyl)benzo(D)isoxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-3-(bromomethyl)-1,2-benzoxazole (CAS 57148-95-5) is a chemical compound with the molecular formula C8H5Br2NO and a molecular weight of 290.94 g/mol. IUPAC name: 5-bromo-3-(bromomethyl)-1,2-benzoxazole. InChIKey: LWNKYNNNQRTKKO-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2NO |
|---|---|
| Molecular weight | 290.94 g/mol |
| IUPAC name | 5-bromo-3-(bromomethyl)-1,2-benzoxazole |
| InChIKey | LWNKYNNNQRTKKO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NO2)CBr |
Computed by PubChem (NCBI)