Products 5717-16-8

CAS 5717-16-8 appears in our catalog under these names: 2-Methyl-4-oxo-4-(4'-methoxyphenyl)butyric acid, 95%, 4-(4-Methoxyphenyl)-2-methyl-4-oxobutanoic acid, 97%, 4-(4-Methoxyphenyl)-2-methyl-4-oxobutanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-(4-methoxyphenyl)-2-methyl-4-oxobutanoic acid (CAS 5717-16-8) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2-methyl-4-oxobutanoic acid. InChIKey: NYKZHPAJYHMOLD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC name4-(4-methoxyphenyl)-2-methyl-4-oxobutanoic acid
InChIKeyNYKZHPAJYHMOLD-UHFFFAOYSA-N
SMILESCC(CC(=O)C1=CC=C(C=C1)OC)C(=O)O

Computed by PubChem (NCBI)