Products 57244-88-9
CAS 57244-88-9 appears in our catalog under these names: 4-Hydroxy-3-methoxyphenyl acetate, 95%, 4-Hydroxy-3-methoxyphenyl acetate, 97%, 4-Hydroxy-3-methoxyphenyl acetate, 4-Hydroxy-3-methoxyphenyl Acetate, ≥95%, ≥95%, 4-HYDROXY-3-METHOXYPHENYL ACETATE, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 1000mg, 500mg.
(4-hydroxy-3-methoxyphenyl) acetate (CAS 57244-88-9) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: (4-hydroxy-3-methoxyphenyl) acetate. InChIKey: KDDIEEVLFYLMLZ-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (4-hydroxy-3-methoxyphenyl) acetate |
| InChIKey | KDDIEEVLFYLMLZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)O)OC |
Computed by PubChem (NCBI)