Products 57264-48-9
CAS 57264-48-9 is the registry number for N-Benzyl-n-tert-butyl-2-chloroacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
N-benzyl-N-tert-butyl-2-chloroacetamide (CAS 57264-48-9) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: N-benzyl-N-tert-butyl-2-chloroacetamide. InChIKey: QVQIAOBUBDFSCF-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | N-benzyl-N-tert-butyl-2-chloroacetamide |
| InChIKey | QVQIAOBUBDFSCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC1=CC=CC=C1)C(=O)CCl |
Computed by PubChem (NCBI)