Products 57369-93-4
CAS 57369-93-4 is the registry number for 2-Hydrazinyl-4,8-dimethylquinoline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(4,8-dimethylquinolin-2-yl)hydrazine (CAS 57369-93-4) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: (4,8-dimethylquinolin-2-yl)hydrazine. InChIKey: IDGTZROMJOZLQC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (4,8-dimethylquinolin-2-yl)hydrazine |
| InChIKey | IDGTZROMJOZLQC-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)NN)C |
Computed by PubChem (NCBI)