Products 57382-97-5
CAS 57382-97-5 appears in our catalog under these names: Ethyl 2–thiopheneacetate, Ethyl 2-(thiophen-2-yl)acetate 95%, Ethyl 2-(thiophen-2-yl)acetate, 95%, 95%, Ethyl 2-thiopheneacetate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 500g, 10g, 50g.
Ethyl 2-thiophen-2-ylacetate (CAS 57382-97-5) is a chemical compound with the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. IUPAC name: ethyl 2-thiophen-2-ylacetate. InChIKey: QSUANHXENVRFDN-UHFFFAOYSA-N.
| Molecular formula | C8H10O2S |
|---|---|
| Molecular weight | 170.23 g/mol |
| IUPAC name | ethyl 2-thiophen-2-ylacetate |
| InChIKey | QSUANHXENVRFDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=CS1 |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2-thienylacetate, 2-Thiopheneacetic acid, ethyl ester, InChI=1/C8H10O2S/c1-2-10-8(9)6-7-4-3-5-11-7/h3-5H,2,6H2,1H, Ethyl 2-thiopheneacetate, ethyl 2-(thiophen-2-yl)acetate, ethyl 2-thiophen-2-ylacetate, Thiopheneacetic acid, ethyl ester, Ethyl thiophene-2-acetate, ethyl 2-(2-thienyl)acetate, Ethyl 2-thiophene acetate