CAS 57409-40-2 is the registry number for N-Benzyl-N,4-dimethylbenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-benzyl-N,4-dimethylbenzamide (CAS 57409-40-2) is a chemical compound with the molecular formula C16H17NO and a molecular weight of 239.31 g/mol. IUPAC name: N-benzyl-N,4-dimethylbenzamide. InChIKey: MSWJDGFXYUCOGB-UHFFFAOYSA-N.
| Molecular formula | C16H17NO |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | N-benzyl-N,4-dimethylbenzamide |
| InChIKey | MSWJDGFXYUCOGB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N(C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)