CAS 57467-17-1 is the registry number for Sodium hydrogen DL-malate, 98% . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 50g, 250g.
Sodium 3,4-dihydroxy-4-oxobutanoate (CAS 57467-17-1) is a chemical compound with the molecular formula C4H5NaO5 and a molecular weight of 156.07 g/mol. IUPAC name: sodium 3,4-dihydroxy-4-oxobutanoate. InChIKey: DOJOZCIMYABYPO-UHFFFAOYSA-M.
| Molecular formula | C4H5NaO5 |
|---|---|
| Molecular weight | 156.07 g/mol |
| IUPAC name | sodium 3,4-dihydroxy-4-oxobutanoate |
| InChIKey | DOJOZCIMYABYPO-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)