CAS 58214-38-3 is the registry number for Dl-malic acid monosodium salt, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 1g, 5g.
Sodium 3,4-dihydroxy-4-oxobutanoate (CAS 58214-38-3) is a chemical compound with the molecular formula C4H5NaO5 and a molecular weight of 156.07 g/mol. IUPAC name: sodium 3,4-dihydroxy-4-oxobutanoate. InChIKey: DOJOZCIMYABYPO-UHFFFAOYSA-M.
| Molecular formula | C4H5NaO5 |
|---|---|
| Molecular weight | 156.07 g/mol |
| IUPAC name | sodium 3,4-dihydroxy-4-oxobutanoate |
| InChIKey | DOJOZCIMYABYPO-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)