CAS 57471-32-6 is the registry number for 3-Acetyl-4-hydroxyaniline Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
1-(5-amino-2-hydroxyphenyl)ethanone;hydrochloride (CAS 57471-32-6) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 1-(5-amino-2-hydroxyphenyl)ethanone;hydrochloride. InChIKey: VDWITVADMLXLNH-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 1-(5-amino-2-hydroxyphenyl)ethanone;hydrochloride |
| InChIKey | VDWITVADMLXLNH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)N)O.Cl |
Computed by PubChem (NCBI)