CAS 5759-76-2 appears in our catalog under these names: 3-Benzyl-6-chloropyrimidine-2,4(1H,3H)-dione, 97%, 3-Benzyl-6-chloro-1H-pyrimidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-benzyl-6-chloro-1H-pyrimidine-2,4-dione (CAS 5759-76-2) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 3-benzyl-6-chloro-1H-pyrimidine-2,4-dione. InChIKey: HVFWAEIVJCCLQR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 3-benzyl-6-chloro-1H-pyrimidine-2,4-dione |
| InChIKey | HVFWAEIVJCCLQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C=C(NC2=O)Cl |
Computed by PubChem (NCBI)