CAS 57591-74-9 appears in our catalog under these names: 5-Benzoyl-4-methyl-1,3-thiazol-2-amine, 95%, 5-Benzoyl-4-methyl-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2-amino-4-methyl-1,3-thiazol-5-yl)-phenylmethanone (CAS 57591-74-9) is a chemical compound with the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. IUPAC name: (2-amino-4-methyl-1,3-thiazol-5-yl)-phenylmethanone. InChIKey: HIAPNRGNWJUYKT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | (2-amino-4-methyl-1,3-thiazol-5-yl)-phenylmethanone |
| InChIKey | HIAPNRGNWJUYKT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)