Products 57598-80-8
CAS 57598-80-8 appears in our catalog under these names: (3E)-4-(1H-indol-3-yl)but-3-en-2-one/ 90%, 4-(Indol-3-yl)-(3E)-buten-2-one, (E)-4-(1H-Indol-3-yl)but-3-en-2-one. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 25 mg.
(E)-4-(1H-indol-3-yl)but-3-en-2-one (CAS 57598-80-8) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (E)-4-(1H-indol-3-yl)but-3-en-2-one. InChIKey: YJRJWAUDTYJBNF-VOTSOKGWSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (E)-4-(1H-indol-3-yl)but-3-en-2-one |
| InChIKey | YJRJWAUDTYJBNF-VOTSOKGWSA-N |
| SMILES | CC(=O)/C=C/C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)