CAS 576-55-6 appears in our catalog under these names: 2,3,4,5-Tetrabromo-6-methylphenol, 98%, Phenol, 2,3,4,5-tetrabromo-6-methyl-, ≥96%, ≥96%, 3,4,5,6-Tetrabromo-o-cresol, 96%, 3,4,5,6-Tetrabromo-o-cresol, >96.0%(GC). Offered by: Fluorochem, Chemat, Combi-blocks, TCI. Available pack sizes: 25g, 1g, 100g, 5g.
2,3,4,5-tetrabromo-6-methylphenol (CAS 576-55-6) is a chemical compound with the molecular formula C7H4Br4O and a molecular weight of 423.72 g/mol. IUPAC name: 2,3,4,5-tetrabromo-6-methylphenol. InChIKey: GGIDUULRWQOXLR-UHFFFAOYSA-N.
| Molecular formula | C7H4Br4O |
|---|---|
| Molecular weight | 423.72 g/mol |
| IUPAC name | 2,3,4,5-tetrabromo-6-methylphenol |
| InChIKey | GGIDUULRWQOXLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)Br)Br)O |
Computed by PubChem (NCBI)