CAS 63394-09-2 is the registry number for 2,6-Dibromo-4-(dibromomethyl)phenol. Offered by: TRC. Available pack sizes: 500mg.
2,6-dibromo-4-(dibromomethyl)phenol (CAS 63394-09-2) is a chemical compound with the molecular formula C7H4Br4O and a molecular weight of 423.72 g/mol. IUPAC name: 2,6-dibromo-4-(dibromomethyl)phenol. InChIKey: HREGPHNNKBDOSE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br4O |
|---|---|
| Molecular weight | 423.72 g/mol |
| IUPAC name | 2,6-dibromo-4-(dibromomethyl)phenol |
| InChIKey | HREGPHNNKBDOSE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C(Br)Br |
Computed by PubChem (NCBI)