Products 57734-56-2
CAS 57734-56-2 is the registry number for Sulpiride Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-N-(pyrrolidin-2-ylmethyl)-5-sulfamoylbenzamide (CAS 57734-56-2) is a chemical compound with the molecular formula C13H19N3O4S and a molecular weight of 313.37 g/mol. IUPAC name: 2-methoxy-N-(pyrrolidin-2-ylmethyl)-5-sulfamoylbenzamide. InChIKey: XUWYBISTYZABLV-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | 2-methoxy-N-(pyrrolidin-2-ylmethyl)-5-sulfamoylbenzamide |
| InChIKey | XUWYBISTYZABLV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)NCC2CCCN2 |
Computed by PubChem (NCBI)