Products 933231-85-7

CAS 933231-85-7 is the registry number for 3-((2-Amino-4-(pyrrolidin-1-ylsulfonyl)phenyl)amino)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-amino-4-pyrrolidin-1-ylsulfonylanilino)propanoic acid (CAS 933231-85-7) is a chemical compound with the molecular formula C13H19N3O4S and a molecular weight of 313.37 g/mol. IUPAC name: 3-(2-amino-4-pyrrolidin-1-ylsulfonylanilino)propanoic acid. InChIKey: GHMXBTIEEKGTIX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19N3O4S
Molecular weight313.37 g/mol
IUPAC name3-(2-amino-4-pyrrolidin-1-ylsulfonylanilino)propanoic acid
InChIKeyGHMXBTIEEKGTIX-UHFFFAOYSA-N
SMILESC1CCN(C1)S(=O)(=O)C2=CC(=C(C=C2)NCCC(=O)O)N

Computed by PubChem (NCBI)