CAS 5774-08-3 appears in our catalog under these names: 6-Methyl-2-naphthoic acid, 98%, 6-Methyl-2-naphthoic acid 98%, 6-Methyl-2-naphthoic acid, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g.
6-methylnaphthalene-2-carboxylic acid (CAS 5774-08-3) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 6-methylnaphthalene-2-carboxylic acid. InChIKey: VOCNMTIGMYPFPY-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-methylnaphthalene-2-carboxylic acid |
| InChIKey | VOCNMTIGMYPFPY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)