CAS 57778-78-6 appears in our catalog under these names: 3-Isocyanato-1H-indole, 95%, 3-Isocyanato-1H-indole, Technical Grade. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg, 50mg, 500mg.
3-isocyanato-1H-indole (CAS 57778-78-6) is a chemical compound with the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. IUPAC name: 3-isocyanato-1H-indole. InChIKey: MOQVAFASDJTQQU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 3-isocyanato-1H-indole |
| InChIKey | MOQVAFASDJTQQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)N=C=O |
Computed by PubChem (NCBI)