CAS 903556-80-9 is the registry number for 2-Methyl-1,3-benzoxazole-5-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-1,3-benzoxazole-5-carbonitrile (CAS 903556-80-9) is a chemical compound with the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. IUPAC name: 2-methyl-1,3-benzoxazole-5-carbonitrile. InChIKey: NAHBXMFWPHJPRC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 2-methyl-1,3-benzoxazole-5-carbonitrile |
| InChIKey | NAHBXMFWPHJPRC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)